About 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole
2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole (PubChem CID 4311842) has the molecular formula C26H22FN3
and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole |
| PubChem CID | 4311842 |
| Molecular Formula | C26H22FN3 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole |
| SMILES | CCCn1c(-c2ccc(F)cc2)cn2c(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C26H22FN3/c1-2-17-29-23(19-13-15-22(27)16-14-19)18-30-25(21-11-7-4-8-12-21)24(28-26(29)30)20-9-5-3-6-10-20/h3-16,18H,2,17H2,1H3 |
| InChIKey | MCVOYLQCKAPEHI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole?
The IUPAC name of 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole (CID 4311842) is 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole.
What is the SMILES notation for 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole?
The canonical SMILES for 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole is CCCn1c(-c2ccc(F)cc2)cn2c(-c3ccccc3)c(-c3ccccc3)nc12.
What is the InChIKey of 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole?
The InChIKey is MCVOYLQCKAPEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22FN3/c1-2-17-29-23(19-13-15-22(27)16-14-19)18-30-25(21-11-7-4-8-12-21)24(28-26(29)30)20-9-5-3-6-10-20/h3-16,18H,2,17H2,1H3.
What are the key properties of 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole?
2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole has a molecular weight of 395.48 g/mol, XLogP of 6.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-5,6-diphenyl-1-propylimidazo[1,2-a]imidazole is sourced from PubChem (CID 4311842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).