C16H17BrFN — CID 43119372
2-bromo-N-[1-(2,5-dimethylphenyl)ethyl]-4-fluoroaniline (PubChem CID 43119372) has the molecular formula C16H17BrFN and a molecular weight of 322.22 g/mol. Its IUPAC name is 2-bromo-N-[1-(2,5-dimethylphenyl)ethyl]-4-fluoroaniline.
| Compound Name | 2-bromo-N-[1-(2,5-dimethylphenyl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 43119372 |
| Molecular Formula | C16H17BrFN |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-bromo-N-[1-(2,5-dimethylphenyl)ethyl]-4-fluoroaniline |
| SMILES | Cc1ccc(C)c(C(C)Nc2ccc(F)cc2Br)c1 |
| InChI | InChI=1S/C16H17BrFN/c1-10-4-5-11(2)14(8-10)12(3)19-16-7-6-13(18)9-15(16)17/h4-9,12,19H,1-3H3 |
| InChIKey | RCOBQUNWFYSQBI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |