About 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine
5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 43119529) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 43119529 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(CCCc2ccccc2)o1 |
| InChI | InChI=1S/C11H13N3O/c12-11-14-13-10(15-11)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,12,14) |
| InChIKey | JEHSJISJSSMCTC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine (CID 43119529) is 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine is Nc1nnc(CCCc2ccccc2)o1.
What is the InChIKey of 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine?
The InChIKey is JEHSJISJSSMCTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c12-11-14-13-10(15-11)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,12,14).
What are the key properties of 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine?
5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine has a molecular weight of 203.25 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-phenylpropyl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 43119529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).