C13H27N3O2S — CID 43119801
N-[1-(aminomethyl)cyclohexyl]-3-methylpiperidine-1-sulfonamide (PubChem CID 43119801) has the molecular formula C13H27N3O2S and a molecular weight of 289.44 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclohexyl]-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-[1-(aminomethyl)cyclohexyl]-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43119801 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[1-(aminomethyl)cyclohexyl]-3-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)NC2(CN)CCCCC2)C1 |
| InChI | InChI=1S/C13H27N3O2S/c1-12-6-5-9-16(10-12)19(17,18)15-13(11-14)7-3-2-4-8-13/h12,15H,2-11,14H2,1H3 |
| InChIKey | VMHWCUOPMBXSNP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |