C10H8ClFN2O — CID 43120187
3-(chloromethyl)-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole (PubChem CID 43120187) has the molecular formula C10H8ClFN2O and a molecular weight of 226.64 g/mol. Its IUPAC name is 3-(chloromethyl)-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(chloromethyl)-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 43120187 |
| Molecular Formula | C10H8ClFN2O |
| Molecular Weight | 226.64 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 3-(chloromethyl)-5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazole |
| SMILES | Fc1cccc(Cc2nc(CCl)no2)c1 |
| InChI | InChI=1S/C10H8ClFN2O/c11-6-9-13-10(15-14-9)5-7-2-1-3-8(12)4-7/h1-4H,5-6H2 |
| InChIKey | FTHOKEKULDOICB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|