C17H20O4 — CID 43120657
3-[(2-methylcyclohexyl)oxymethyl]-1-benzofuran-2-carboxylic acid (PubChem CID 43120657) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 3-[(2-methylcyclohexyl)oxymethyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[(2-methylcyclohexyl)oxymethyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 43120657 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[(2-methylcyclohexyl)oxymethyl]-1-benzofuran-2-carboxylic acid |
| SMILES | CC1CCCCC1OCc1c(C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C17H20O4/c1-11-6-2-4-8-14(11)20-10-13-12-7-3-5-9-15(12)21-16(13)17(18)19/h3,5,7,9,11,14H,2,4,6,8,10H2,1H3,(H,18,19) |
| InChIKey | UDKUQIPRUPPKRO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |