C12H9N3O2 — CID 43120908
3-[(2,4-dioxopyrimidin-1-yl)methyl]benzonitrile (PubChem CID 43120908) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-[(2,4-dioxopyrimidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(2,4-dioxopyrimidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 43120908 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-[(2,4-dioxopyrimidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H9N3O2/c13-7-9-2-1-3-10(6-9)8-15-5-4-11(16)14-12(15)17/h1-6H,8H2,(H,14,16,17) |
| InChIKey | YWIOQQGDSUNKRC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |