About 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide
2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide (PubChem CID 43120914) has the molecular formula C12H11N3O2S
and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide |
| PubChem CID | 43120914 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H11N3O2S/c13-11(18)9-4-2-1-3-8(9)7-15-6-5-10(16)14-12(15)17/h1-6H,7H2,(H2,13,18)(H,14,16,17) |
| InChIKey | KIJPYNZEJHLXOZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide?
The IUPAC name of 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide (CID 43120914) is 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide.
What is the SMILES notation for 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide?
The canonical SMILES for 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide is NC(=S)c1ccccc1Cn1ccc(=O)[nH]c1=O.
What is the InChIKey of 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide?
The InChIKey is KIJPYNZEJHLXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2S/c13-11(18)9-4-2-1-3-8(9)7-15-6-5-10(16)14-12(15)17/h1-6H,7H2,(H2,13,18)(H,14,16,17).
What are the key properties of 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide?
2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide has a molecular weight of 261.31 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dioxopyrimidin-1-yl)methyl]benzenecarbothioamide is sourced from PubChem (CID 43120914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).