C17H17Cl2N — CID 43121155
1-[3-chloro-2-(chloromethyl)phenyl]-2-methyl-3,4-dihydro-2H-quinoline (PubChem CID 43121155) has the molecular formula C17H17Cl2N and a molecular weight of 306.24 g/mol. Its IUPAC name is 1-[3-chloro-2-(chloromethyl)phenyl]-2-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[3-chloro-2-(chloromethyl)phenyl]-2-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 43121155 |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-[3-chloro-2-(chloromethyl)phenyl]-2-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1CCc2ccccc2N1c1cccc(Cl)c1CCl |
| InChI | InChI=1S/C17H17Cl2N/c1-12-9-10-13-5-2-3-7-16(13)20(12)17-8-4-6-15(19)14(17)11-18/h2-8,12H,9-11H2,1H3 |
| InChIKey | LHGUSZFRVXYTMJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|