C26H25ClN4O3 — CID 4312158
methyl 6-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate (PubChem CID 4312158) has the molecular formula C26H25ClN4O3 and a molecular weight of 476.96 g/mol. Its IUPAC name is methyl 6-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate.
| Compound Name | methyl 6-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate |
|---|---|
| PubChem CID | 4312158 |
| Molecular Formula | C26H25ClN4O3 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 6-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepine-8-carboxylate |
| SMILES | COC(=O)C1C(=O)C2=C(CC1C)Nc1ccccc1NC2c1c(C)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C26H25ClN4O3/c1-14-13-19-22(24(32)20(14)26(33)34-3)23(29-18-12-8-7-11-17(18)28-19)21-15(2)30-31(25(21)27)16-9-5-4-6-10-16/h4-12,14,20,23,28-29H,13H2,1-3H3 |
| InChIKey | MIOHDORLIAOWSR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|