About 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine
3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 43121970) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 43121970 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | [H]/N=C1\CCCN1CCCN(C)C |
| InChI | InChI=1S/C9H19N3/c1-11(2)6-4-8-12-7-3-5-9(12)10/h10H,3-8H2,1-2H3/b10-9+ |
| InChIKey | GQFSEUROBYWIRB-MDZDMXLPSA-N |
| XLogP | 1.01 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine (CID 43121970) is 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine is [H]/N=C1\CCCN1CCCN(C)C.
What is the InChIKey of 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is GQFSEUROBYWIRB-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H19N3/c1-11(2)6-4-8-12-7-3-5-9(12)10/h10H,3-8H2,1-2H3/b10-9+.
What are the key properties of 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine?
3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 169.27 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-iminopyrrolidin-1-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 43121970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).