C16H26O2 — CID 4312221
2,2,3,8,9,9-hexamethyldeca-4,6-diyne-3,8-diol (PubChem CID 4312221) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2,2,3,8,9,9-hexamethyldeca-4,6-diyne-3,8-diol.
| Compound Name | 2,2,3,8,9,9-hexamethyldeca-4,6-diyne-3,8-diol |
|---|---|
| PubChem CID | 4312221 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2,2,3,8,9,9-hexamethyldeca-4,6-diyne-3,8-diol |
| SMILES | CC(C)(C)C(C)(O)C#CC#CC(C)(O)C(C)(C)C |
| InChI | InChI=1S/C16H26O2/c1-13(2,3)15(7,17)11-9-10-12-16(8,18)14(4,5)6/h17-18H,1-8H3 |
| InChIKey | XMWWMDJAIAFYHT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|