C12H13N5O3 — CID 4312365
N,N,5-trimethyl-1-(4-nitrophenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 4312365) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is N,N,5-trimethyl-1-(4-nitrophenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N,N,5-trimethyl-1-(4-nitrophenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 4312365 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N,N,5-trimethyl-1-(4-nitrophenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)N(C)C)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H13N5O3/c1-8-13-11(12(18)15(2)3)14-16(8)9-4-6-10(7-5-9)17(19)20/h4-7H,1-3H3 |
| InChIKey | MJFSHJHYKJYNTL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|