C15H21F2N — CID 43123923
2,6-difluoro-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 43123923) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is 2,6-difluoro-N-(3,3,5-trimethylcyclohexyl)aniline.
| Compound Name | 2,6-difluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 43123923 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2,6-difluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(Nc2c(F)cccc2F)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21F2N/c1-10-7-11(9-15(2,3)8-10)18-14-12(16)5-4-6-13(14)17/h4-6,10-11,18H,7-9H2,1-3H3 |
| InChIKey | VFNLBXKSWNQNHY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |