C13H15IN2S — CID 43124277
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-iodoaniline (PubChem CID 43124277) has the molecular formula C13H15IN2S and a molecular weight of 358.25 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-iodoaniline.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-iodoaniline |
|---|---|
| PubChem CID | 43124277 |
| Molecular Formula | C13H15IN2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-iodoaniline |
| SMILES | Cc1nc(C(C)Nc2ccc(I)cc2)c(C)s1 |
| InChI | InChI=1S/C13H15IN2S/c1-8(13-9(2)17-10(3)16-13)15-12-6-4-11(14)5-7-12/h4-8,15H,1-3H3 |
| InChIKey | GJPNEHVUVHGAGE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|