C16H9Cl3N2O3S — CID 4312432
(2,3-dichlorophenyl) 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 4312432) has the molecular formula C16H9Cl3N2O3S and a molecular weight of 415.69 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (2,3-dichlorophenyl) 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 4312432 |
| Molecular Formula | C16H9Cl3N2O3S |
| Molecular Weight | 415.69 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | (2,3-dichlorophenyl) 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | O=C(CSc1nnc(-c2ccccc2Cl)o1)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H9Cl3N2O3S/c17-10-5-2-1-4-9(10)15-20-21-16(24-15)25-8-13(22)23-12-7-3-6-11(18)14(12)19/h1-7H,8H2 |
| InChIKey | CRBBQJSIXRBFRE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|