About 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline
2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline (PubChem CID 43124682) has the molecular formula C17H20IN
and a molecular weight of 365.26 g/mol. Its IUPAC name is 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline.
Molecular Properties
| Compound Name | 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline |
| PubChem CID | 43124682 |
| Molecular Formula | C17H20IN |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline |
| SMILES | Cc1cc(C)c(C(C)Nc2ccccc2I)cc1C |
| InChI | InChI=1S/C17H20IN/c1-11-9-13(3)15(10-12(11)2)14(4)19-17-8-6-5-7-16(17)18/h5-10,14,19H,1-4H3 |
| InChIKey | ZDMNJBDSOFRPMO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline?
The IUPAC name of 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline (CID 43124682) is 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline.
What is the SMILES notation for 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline?
The canonical SMILES for 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline is Cc1cc(C)c(C(C)Nc2ccccc2I)cc1C.
What is the InChIKey of 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline?
The InChIKey is ZDMNJBDSOFRPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20IN/c1-11-9-13(3)15(10-12(11)2)14(4)19-17-8-6-5-7-16(17)18/h5-10,14,19H,1-4H3.
What are the key properties of 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline?
2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline has a molecular weight of 365.26 g/mol, XLogP of 5.39, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N-[1-(2,4,5-trimethylphenyl)ethyl]aniline is sourced from PubChem (CID 43124682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).