About 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline
4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline (PubChem CID 43126573) has the molecular formula C14H10BrCl3FN
and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline.
Molecular Properties
| Compound Name | 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline |
| PubChem CID | 43126573 |
| Molecular Formula | C14H10BrCl3FN |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 394.90 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline |
| SMILES | CC(Nc1c(Cl)cc(Br)cc1Cl)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrCl3FN/c1-7(8-2-3-13(19)10(16)4-8)20-14-11(17)5-9(15)6-12(14)18/h2-7,20H,1H3 |
| InChIKey | ZQIKXNACCORYLS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline?
The IUPAC name of 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline (CID 43126573) is 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline.
What is the SMILES notation for 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline?
The canonical SMILES for 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline is CC(Nc1c(Cl)cc(Br)cc1Cl)c1ccc(F)c(Cl)c1.
What is the InChIKey of 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline?
The InChIKey is ZQIKXNACCORYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrCl3FN/c1-7(8-2-3-13(19)10(16)4-8)20-14-11(17)5-9(15)6-12(14)18/h2-7,20H,1H3.
What are the key properties of 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline?
4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline has a molecular weight of 397.50 g/mol, XLogP of 6.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dichloro-N-[1-(3-chloro-4-fluorophenyl)ethyl]aniline is sourced from PubChem (CID 43126573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).