About 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one
3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one (PubChem CID 43126586) has the molecular formula C14H8BrCl3N2O
and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one |
| PubChem CID | 43126586 |
| Molecular Formula | C14H8BrCl3N2O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C14H8BrCl3N2O/c15-6-3-9(17)13(10(18)4-6)20-12-8-5-7(16)1-2-11(8)19-14(12)21/h1-5,12,20H,(H,19,21) |
| InChIKey | VOAVSOVYTWKSNY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one?
The IUPAC name of 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one (CID 43126586) is 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one?
The canonical SMILES for 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one is O=C1Nc2ccc(Cl)cc2C1Nc1c(Cl)cc(Br)cc1Cl.
What is the InChIKey of 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one?
The InChIKey is VOAVSOVYTWKSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrCl3N2O/c15-6-3-9(17)13(10(18)4-6)20-12-8-5-7(16)1-2-11(8)19-14(12)21/h1-5,12,20H,(H,19,21).
What are the key properties of 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one?
3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one has a molecular weight of 406.49 g/mol, XLogP of 5.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-2,6-dichloroanilino)-5-chloro-1,3-dihydroindol-2-one is sourced from PubChem (CID 43126586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).