C16H22F3NO — CID 43126976
5-(trifluoromethyl)-2-(3,3,5-trimethylcyclohexyl)oxyaniline (PubChem CID 43126976) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-(3,3,5-trimethylcyclohexyl)oxyaniline.
| Compound Name | 5-(trifluoromethyl)-2-(3,3,5-trimethylcyclohexyl)oxyaniline |
|---|---|
| PubChem CID | 43126976 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 5-(trifluoromethyl)-2-(3,3,5-trimethylcyclohexyl)oxyaniline |
| SMILES | CC1CC(Oc2ccc(C(F)(F)F)cc2N)CC(C)(C)C1 |
| InChI | InChI=1S/C16H22F3NO/c1-10-6-12(9-15(2,3)8-10)21-14-5-4-11(7-13(14)20)16(17,18)19/h4-5,7,10,12H,6,8-9,20H2,1-3H3 |
| InChIKey | JZXPQRBJCSJVFB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|