About 3-(octoxymethyl)aniline
3-(octoxymethyl)aniline (PubChem CID 43127234) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-(octoxymethyl)aniline.
Molecular Properties
| Compound Name | 3-(octoxymethyl)aniline |
| PubChem CID | 43127234 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-(octoxymethyl)aniline |
| SMILES | CCCCCCCCOCc1cccc(N)c1 |
| InChI | InChI=1S/C15H25NO/c1-2-3-4-5-6-7-11-17-13-14-9-8-10-15(16)12-14/h8-10,12H,2-7,11,13,16H2,1H3 |
| InChIKey | XEFBWLJBKZJSDY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(octoxymethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(octoxymethyl)aniline?
The IUPAC name of 3-(octoxymethyl)aniline (CID 43127234) is 3-(octoxymethyl)aniline.
What is the SMILES notation for 3-(octoxymethyl)aniline?
The canonical SMILES for 3-(octoxymethyl)aniline is CCCCCCCCOCc1cccc(N)c1.
What is the InChIKey of 3-(octoxymethyl)aniline?
The InChIKey is XEFBWLJBKZJSDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-2-3-4-5-6-7-11-17-13-14-9-8-10-15(16)12-14/h8-10,12H,2-7,11,13,16H2,1H3.
What are the key properties of 3-(octoxymethyl)aniline?
3-(octoxymethyl)aniline has a molecular weight of 235.37 g/mol, XLogP of 4.15, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(octoxymethyl)aniline is sourced from PubChem (CID 43127234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).