About 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine
7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 43127758) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
Molecular Properties
| Compound Name | 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| PubChem CID | 43127758 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | CC(C)CCCOC1CC2(CCC1N)OCCO2 |
| InChI | InChI=1S/C14H27NO3/c1-11(2)4-3-7-16-13-10-14(6-5-12(13)15)17-8-9-18-14/h11-13H,3-10,15H2,1-2H3 |
| InChIKey | CJKZKSJWFFFAMG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
The IUPAC name of 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine (CID 43127758) is 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
What is the SMILES notation for 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
The canonical SMILES for 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine is CC(C)CCCOC1CC2(CCC1N)OCCO2.
What is the InChIKey of 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
The InChIKey is CJKZKSJWFFFAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-11(2)4-3-7-16-13-10-14(6-5-12(13)15)17-8-9-18-14/h11-13H,3-10,15H2,1-2H3.
What are the key properties of 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine has a molecular weight of 257.37 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methylpentoxy)-1,4-dioxaspiro[4.5]decan-8-amine is sourced from PubChem (CID 43127758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).