About 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide
4-(2-butoxyethoxy)-N'-hydroxybutanimidamide (PubChem CID 43128368) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide |
| PubChem CID | 43128368 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide |
| SMILES | CCCCOCCOCCC/C(N)=N/O |
| InChI | InChI=1S/C10H22N2O3/c1-2-3-6-14-8-9-15-7-4-5-10(11)12-13/h13H,2-9H2,1H3,(H2,11,12) |
| InChIKey | VPKJSFMEWIHUBV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide?
The IUPAC name of 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide (CID 43128368) is 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide?
The canonical SMILES for 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide is CCCCOCCOCCC/C(N)=N/O.
What is the InChIKey of 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide?
The InChIKey is VPKJSFMEWIHUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3/c1-2-3-6-14-8-9-15-7-4-5-10(11)12-13/h13H,2-9H2,1H3,(H2,11,12).
What are the key properties of 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide?
4-(2-butoxyethoxy)-N'-hydroxybutanimidamide has a molecular weight of 218.30 g/mol, XLogP of 1.35, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butoxyethoxy)-N'-hydroxybutanimidamide is sourced from PubChem (CID 43128368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).