C15H17NO5 — CID 43128779
5-[(6-methylcyclohex-3-en-1-yl)methoxy]-2-nitrobenzoic acid (PubChem CID 43128779) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 5-[(6-methylcyclohex-3-en-1-yl)methoxy]-2-nitrobenzoic acid.
| Compound Name | 5-[(6-methylcyclohex-3-en-1-yl)methoxy]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 43128779 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-[(6-methylcyclohex-3-en-1-yl)methoxy]-2-nitrobenzoic acid |
| SMILES | CC1CC=CCC1COc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C15H17NO5/c1-10-4-2-3-5-11(10)9-21-12-6-7-14(16(19)20)13(8-12)15(17)18/h2-3,6-8,10-11H,4-5,9H2,1H3,(H,17,18) |
| InChIKey | IXNKJMUXFJLHHV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|