C13H13N3OS — CID 43128879
6-(2-pyridin-2-ylethoxy)pyridine-3-carbothioamide (PubChem CID 43128879) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 6-(2-pyridin-2-ylethoxy)pyridine-3-carbothioamide.
| Compound Name | 6-(2-pyridin-2-ylethoxy)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 43128879 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 6-(2-pyridin-2-ylethoxy)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(OCCc2ccccn2)nc1 |
| InChI | InChI=1S/C13H13N3OS/c14-13(18)10-4-5-12(16-9-10)17-8-6-11-3-1-2-7-15-11/h1-5,7,9H,6,8H2,(H2,14,18) |
| InChIKey | MIHBIGGCCIDNCM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|