About 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine
2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine (PubChem CID 43130147) has the molecular formula C16H30N4S
and a molecular weight of 310.51 g/mol. Its IUPAC name is 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine |
| PubChem CID | 43130147 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine |
| SMILES | CCCCCCC(C)(CN)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H30N4S/c1-3-4-5-6-7-16(2,14-17)20-11-9-19(10-12-20)15-18-8-13-21-15/h8,13H,3-7,9-12,14,17H2,1-2H3 |
| InChIKey | DLRKYZCBOMVHHN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine?
The IUPAC name of 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine (CID 43130147) is 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine.
What is the SMILES notation for 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine?
The canonical SMILES for 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine is CCCCCCC(C)(CN)N1CCN(c2nccs2)CC1.
What is the InChIKey of 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine?
The InChIKey is DLRKYZCBOMVHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4S/c1-3-4-5-6-7-16(2,14-17)20-11-9-19(10-12-20)15-18-8-13-21-15/h8,13H,3-7,9-12,14,17H2,1-2H3.
What are the key properties of 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine?
2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine has a molecular weight of 310.51 g/mol, XLogP of 2.95, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]octan-1-amine is sourced from PubChem (CID 43130147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).