About 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one
3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one (PubChem CID 4313048) has the molecular formula C11H10BrN3O
and a molecular weight of 280.12 g/mol. Its IUPAC name is 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one.
Molecular Properties
| Compound Name | 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one |
| PubChem CID | 4313048 |
| Molecular Formula | C11H10BrN3O |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one |
| SMILES | O=c1c2ccccc2nc2n1C(CBr)CN2 |
| InChI | InChI=1S/C11H10BrN3O/c12-5-7-6-13-11-14-9-4-2-1-3-8(9)10(16)15(7)11/h1-4,7H,5-6H2,(H,13,14) |
| InChIKey | AASBVFFQGULZET-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one?
The IUPAC name of 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one (CID 4313048) is 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one.
What is the SMILES notation for 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one?
The canonical SMILES for 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one is O=c1c2ccccc2nc2n1C(CBr)CN2.
What is the InChIKey of 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one?
The InChIKey is AASBVFFQGULZET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN3O/c12-5-7-6-13-11-14-9-4-2-1-3-8(9)10(16)15(7)11/h1-4,7H,5-6H2,(H,13,14).
What are the key properties of 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one?
3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one has a molecular weight of 280.12 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-2,3-dihydro-1H-imidazo[2,1-b]quinazolin-5-one is sourced from PubChem (CID 4313048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).