C13H16BrN3O — CID 43130847
3-(4-aminopiperidin-1-yl)-6-bromo-1,3-dihydroindol-2-one (PubChem CID 43130847) has the molecular formula C13H16BrN3O and a molecular weight of 310.19 g/mol. Its IUPAC name is 3-(4-aminopiperidin-1-yl)-6-bromo-1,3-dihydroindol-2-one.
| Compound Name | 3-(4-aminopiperidin-1-yl)-6-bromo-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43130847 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3-(4-aminopiperidin-1-yl)-6-bromo-1,3-dihydroindol-2-one |
| SMILES | NC1CCN(C2C(=O)Nc3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C13H16BrN3O/c14-8-1-2-10-11(7-8)16-13(18)12(10)17-5-3-9(15)4-6-17/h1-2,7,9,12H,3-6,15H2,(H,16,18) |
| InChIKey | QLVFQAGRJBWDKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |