About [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol
[1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol (PubChem CID 43133230) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol |
| PubChem CID | 43133230 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol |
| SMILES | Cc1nn(C)c(N2CCC(CO)CC2)c1CN |
| InChI | InChI=1S/C12H22N4O/c1-9-11(7-13)12(15(2)14-9)16-5-3-10(8-17)4-6-16/h10,17H,3-8,13H2,1-2H3 |
| InChIKey | XZGUHTAMTJPTNJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol?
The IUPAC name of [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol (CID 43133230) is [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol is Cc1nn(C)c(N2CCC(CO)CC2)c1CN.
What is the InChIKey of [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol?
The InChIKey is XZGUHTAMTJPTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-9-11(7-13)12(15(2)14-9)16-5-3-10(8-17)4-6-16/h10,17H,3-8,13H2,1-2H3.
What are the key properties of [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol?
[1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol has a molecular weight of 238.33 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(aminomethyl)-1,3-dimethylpyrazol-5-yl]piperidin-4-yl]methanol is sourced from PubChem (CID 43133230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).