C13H18BrNO2 — CID 43133571
N-(3-bromopropyl)-3-(4-methoxyphenyl)propanamide (PubChem CID 43133571) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is N-(3-bromopropyl)-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-(3-bromopropyl)-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 43133571 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(3-bromopropyl)-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCCBr)cc1 |
| InChI | InChI=1S/C13H18BrNO2/c1-17-12-6-3-11(4-7-12)5-8-13(16)15-10-2-9-14/h3-4,6-7H,2,5,8-10H2,1H3,(H,15,16) |
| InChIKey | RLZFBXYNTUMMID-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|