C7H11BrN2O3S — CID 43133689
N-(2-bromoethyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide (PubChem CID 43133689) has the molecular formula C7H11BrN2O3S and a molecular weight of 283.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide.
| Compound Name | N-(2-bromoethyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 43133689 |
| Molecular Formula | C7H11BrN2O3S |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | N-(2-bromoethyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
| SMILES | Cc1cc(CS(=O)(=O)NCCBr)no1 |
| InChI | InChI=1S/C7H11BrN2O3S/c1-6-4-7(10-13-6)5-14(11,12)9-3-2-8/h4,9H,2-3,5H2,1H3 |
| InChIKey | YPRXLPYMWAMBFB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|