C14H13BrN2O3S — CID 43134004
2-bromo-N-(3-methyl-4-sulfamoylphenyl)benzamide (PubChem CID 43134004) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is 2-bromo-N-(3-methyl-4-sulfamoylphenyl)benzamide.
| Compound Name | 2-bromo-N-(3-methyl-4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 43134004 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 2-bromo-N-(3-methyl-4-sulfamoylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2Br)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H13BrN2O3S/c1-9-8-10(6-7-13(9)21(16,19)20)17-14(18)11-4-2-3-5-12(11)15/h2-8H,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | GEPKDCBUFKMQJI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |