C7H10F2N2O4S3 — CID 43134152
5-[1-(difluoromethylsulfonylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 43134152) has the molecular formula C7H10F2N2O4S3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 5-[1-(difluoromethylsulfonylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[1-(difluoromethylsulfonylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43134152 |
| Molecular Formula | C7H10F2N2O4S3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5-[1-(difluoromethylsulfonylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)C(F)F)c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H10F2N2O4S3/c1-4(11-18(14,15)7(8)9)5-2-3-6(16-5)17(10,12)13/h2-4,7,11H,1H3,(H2,10,12,13) |
| InChIKey | NCGXSVPLXHDBCL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |