C12H11BrFNO — CID 43134311
(2E,4E)-N-(2-bromo-4-fluorophenyl)hexa-2,4-dienamide (PubChem CID 43134311) has the molecular formula C12H11BrFNO and a molecular weight of 284.13 g/mol. Its IUPAC name is (2E,4E)-N-(2-bromo-4-fluorophenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-bromo-4-fluorophenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 43134311 |
| Molecular Formula | C12H11BrFNO |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (2E,4E)-N-(2-bromo-4-fluorophenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H11BrFNO/c1-2-3-4-5-12(16)15-11-7-6-9(14)8-10(11)13/h2-8H,1H3,(H,15,16)/b3-2+,5-4+ |
| InChIKey | IQGWOHGBUUHIIU-MQQKCMAXSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|