About 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine
5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine (PubChem CID 43134491) has the molecular formula C10H8F2N4O
and a molecular weight of 238.20 g/mol. Its IUPAC name is 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine.
Molecular Properties
| Compound Name | 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine |
| PubChem CID | 43134491 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine |
| SMILES | Nc1nncc(-c2ccccc2OC(F)F)n1 |
| InChI | InChI=1S/C10H8F2N4O/c11-9(12)17-8-4-2-1-3-6(8)7-5-14-16-10(13)15-7/h1-5,9H,(H2,13,15,16) |
| InChIKey | JOSVPPHTKREXOM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine?
The IUPAC name of 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine (CID 43134491) is 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine.
What is the SMILES notation for 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine?
The canonical SMILES for 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine is Nc1nncc(-c2ccccc2OC(F)F)n1.
What is the InChIKey of 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine?
The InChIKey is JOSVPPHTKREXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4O/c11-9(12)17-8-4-2-1-3-6(8)7-5-14-16-10(13)15-7/h1-5,9H,(H2,13,15,16).
What are the key properties of 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine?
5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine has a molecular weight of 238.20 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine is sourced from PubChem (CID 43134491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).