C9H6F2N4 — CID 43134548
5-(3,4-difluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 43134548) has the molecular formula C9H6F2N4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(3,4-difluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 43134548 |
| Molecular Formula | C9H6F2N4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 5-(3,4-difluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Nc1nncc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C9H6F2N4/c10-6-2-1-5(3-7(6)11)8-4-13-15-9(12)14-8/h1-4H,(H2,12,14,15) |
| InChIKey | WKBBLBRBXBJLDY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |