About ethyl 3-amino-2-methylbenzoate
ethyl 3-amino-2-methylbenzoate (PubChem CID 4313471) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is ethyl 3-amino-2-methylbenzoate.
Molecular Properties
| Compound Name | ethyl 3-amino-2-methylbenzoate |
| PubChem CID | 4313471 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | ethyl 3-amino-2-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(N)c1C |
| InChI | InChI=1S/C10H13NO2/c1-3-13-10(12)8-5-4-6-9(11)7(8)2/h4-6H,3,11H2,1-2H3 |
| InChIKey | RZDRJEHTKWQFQO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-2-methylbenzoate?
The IUPAC name of ethyl 3-amino-2-methylbenzoate (CID 4313471) is ethyl 3-amino-2-methylbenzoate.
What is the SMILES notation for ethyl 3-amino-2-methylbenzoate?
The canonical SMILES for ethyl 3-amino-2-methylbenzoate is CCOC(=O)c1cccc(N)c1C.
What is the InChIKey of ethyl 3-amino-2-methylbenzoate?
The InChIKey is RZDRJEHTKWQFQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-3-13-10(12)8-5-4-6-9(11)7(8)2/h4-6H,3,11H2,1-2H3.
What are the key properties of ethyl 3-amino-2-methylbenzoate?
ethyl 3-amino-2-methylbenzoate has a molecular weight of 179.22 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-2-methylbenzoate is sourced from PubChem (CID 4313471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).