C11H15NO3 — CID 43135042
2-[1-(2-hydroxy-4-methylphenyl)ethylamino]acetic acid (PubChem CID 43135042) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-[1-(2-hydroxy-4-methylphenyl)ethylamino]acetic acid.
| Compound Name | 2-[1-(2-hydroxy-4-methylphenyl)ethylamino]acetic acid |
|---|---|
| PubChem CID | 43135042 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-[1-(2-hydroxy-4-methylphenyl)ethylamino]acetic acid |
| SMILES | Cc1ccc(C(C)NCC(=O)O)c(O)c1 |
| InChI | InChI=1S/C11H15NO3/c1-7-3-4-9(10(13)5-7)8(2)12-6-11(14)15/h3-5,8,12-13H,6H2,1-2H3,(H,14,15) |
| InChIKey | WCUZMZUFQCFDGK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|