About 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid
2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid (PubChem CID 43135652) has the molecular formula C6H8N4O3S
and a molecular weight of 216.22 g/mol. Its IUPAC name is 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid |
| PubChem CID | 43135652 |
| Molecular Formula | C6H8N4O3S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C6H8N4O3S/c1-10(2-4(11)12)6(13)8-5-9-7-3-14-5/h3H,2H2,1H3,(H,11,12)(H,8,9,13) |
| InChIKey | RQHPUVHATKDHES-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
The IUPAC name of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid (CID 43135652) is 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid.
What is the SMILES notation for 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
The canonical SMILES for 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid is CN(CC(=O)O)C(=O)Nc1nncs1.
What is the InChIKey of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
The InChIKey is RQHPUVHATKDHES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3S/c1-10(2-4(11)12)6(13)8-5-9-7-3-14-5/h3H,2H2,1H3,(H,11,12)(H,8,9,13).
What are the key properties of 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid has a molecular weight of 216.22 g/mol, XLogP of 0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid is sourced from PubChem (CID 43135652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).