About N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine
N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 43136956) has the molecular formula C8H21N3O2S
and a molecular weight of 223.34 g/mol. Its IUPAC name is N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine |
| PubChem CID | 43136956 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)N(CCCN)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H21N3O2S/c1-8(2)11(7-5-6-9)14(12,13)10(3)4/h8H,5-7,9H2,1-4H3 |
| InChIKey | BONWWVBLHPCQIR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine?
The IUPAC name of N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine (CID 43136956) is N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine.
What is the SMILES notation for N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine?
The canonical SMILES for N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine is CC(C)N(CCCN)S(=O)(=O)N(C)C.
What is the InChIKey of N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine?
The InChIKey is BONWWVBLHPCQIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21N3O2S/c1-8(2)11(7-5-6-9)14(12,13)10(3)4/h8H,5-7,9H2,1-4H3.
What are the key properties of N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine?
N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine has a molecular weight of 223.34 g/mol, XLogP of -0.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(dimethylsulfamoyl)-N'-propan-2-ylpropane-1,3-diamine is sourced from PubChem (CID 43136956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).