About 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine
3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 4313744) has the molecular formula C19H22FNO3S
and a molecular weight of 363.45 g/mol. Its IUPAC name is 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 4313744 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)C(C(C)(C)C)CO2 |
| InChI | InChI=1S/C19H22FNO3S/c1-13-5-10-17-16(11-13)21(18(12-24-17)19(2,3)4)25(22,23)15-8-6-14(20)7-9-15/h5-11,18H,12H2,1-4H3 |
| InChIKey | OOXXKVVBPSCJHO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine (CID 4313744) is 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine is Cc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)C(C(C)(C)C)CO2.
What is the InChIKey of 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is OOXXKVVBPSCJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO3S/c1-13-5-10-17-16(11-13)21(18(12-24-17)19(2,3)4)25(22,23)15-8-6-14(20)7-9-15/h5-11,18H,12H2,1-4H3.
What are the key properties of 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine?
3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 363.45 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-(4-fluorophenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 4313744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).