C8H8ClF3N2OS — CID 43138083
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 43138083) has the molecular formula C8H8ClF3N2OS and a molecular weight of 272.68 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 43138083 |
| Molecular Formula | C8H8ClF3N2OS |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)NCC(F)(F)F |
| InChI | InChI=1S/C8H8ClF3N2OS/c9-2-5-3-16-7(14-5)1-6(15)13-4-8(10,11)12/h3H,1-2,4H2,(H,13,15) |
| InChIKey | UANUXEHWTCBCPR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|