C9H11ClF3NOS — CID 43138137
4-(chloromethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-thiazole (PubChem CID 43138137) has the molecular formula C9H11ClF3NOS and a molecular weight of 273.71 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43138137 |
| Molecular Formula | C9H11ClF3NOS |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-(chloromethyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-thiazole |
| SMILES | FC(F)(F)COCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H11ClF3NOS/c10-4-7-5-16-8(14-7)2-1-3-15-6-9(11,12)13/h5H,1-4,6H2 |
| InChIKey | DAOQZTUTZVJEIY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|