C15H16ClNOS — CID 43138207
4-(chloromethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazole (PubChem CID 43138207) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 43138207 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-(chloromethyl)-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazole |
| SMILES | ClCc1csc(COC2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C15H16ClNOS/c16-8-12-10-19-15(17-12)9-18-14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,10,14H,3,5,7-9H2 |
| InChIKey | FIWHYBCBRZIGJQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|