About 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione
2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione (PubChem CID 43138463) has the molecular formula C10H10ClN3O2S
and a molecular weight of 271.73 g/mol. Its IUPAC name is 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione |
| PubChem CID | 43138463 |
| Molecular Formula | C10H10ClN3O2S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(CCc2nc(CCl)cs2)[nH]1 |
| InChI | InChI=1S/C10H10ClN3O2S/c11-5-7-6-17-9(12-7)3-4-14-10(16)2-1-8(15)13-14/h1-2,6H,3-5H2,(H,13,15) |
| InChIKey | CJLMWJUHYQIOGF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione?
The IUPAC name of 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione (CID 43138463) is 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione is O=c1ccc(=O)n(CCc2nc(CCl)cs2)[nH]1.
What is the InChIKey of 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione?
The InChIKey is CJLMWJUHYQIOGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O2S/c11-5-7-6-17-9(12-7)3-4-14-10(16)2-1-8(15)13-14/h1-2,6H,3-5H2,(H,13,15).
What are the key properties of 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione?
2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione has a molecular weight of 271.73 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1H-pyridazine-3,6-dione is sourced from PubChem (CID 43138463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).