C10H12ClN3O2S — CID 43138467
3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 43138467) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43138467 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CCc2nc(CCl)cs2)C1=O |
| InChI | InChI=1S/C10H12ClN3O2S/c1-13-5-9(15)14(10(13)16)3-2-8-12-7(4-11)6-17-8/h6H,2-5H2,1H3 |
| InChIKey | BSRSUFIWVHRSAF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|