C13H16F3N3O — CID 43138481
4-(1,4-diazepan-1-yl)-2-(trifluoromethyl)benzamide (PubChem CID 43138481) has the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-(1,4-diazepan-1-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 43138481 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-2-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(N2CCCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)11-8-9(2-3-10(11)12(17)20)19-6-1-4-18-5-7-19/h2-3,8,18H,1,4-7H2,(H2,17,20) |
| InChIKey | QUIAQRQXPLFUCH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |