About 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide
4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 43138678) has the molecular formula C15H20F3N3
and a molecular weight of 299.34 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide |
| PubChem CID | 43138678 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(C)CC(C)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3/c1-9-5-10(2)8-21(7-9)11-3-4-12(14(19)20)13(6-11)15(16,17)18/h3-4,6,9-10H,5,7-8H2,1-2H3,(H3,19,20) |
| InChIKey | PCZOILRSBXGAGZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide?
The IUPAC name of 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide (CID 43138678) is 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide.
What is the SMILES notation for 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide?
The canonical SMILES for 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide is [H]/N=C(\N)c1ccc(N2CC(C)CC(C)C2)cc1C(F)(F)F.
What is the InChIKey of 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide?
The InChIKey is PCZOILRSBXGAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3N3/c1-9-5-10(2)8-21(7-9)11-3-4-12(14(19)20)13(6-11)15(16,17)18/h3-4,6,9-10H,5,7-8H2,1-2H3,(H3,19,20).
What are the key properties of 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide?
4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide has a molecular weight of 299.34 g/mol, XLogP of 3.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpiperidin-1-yl)-2-(trifluoromethyl)benzenecarboximidamide is sourced from PubChem (CID 43138678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).