About 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid
3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid (PubChem CID 43139865) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid |
| PubChem CID | 43139865 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid |
| SMILES | CC1CC(NCCC(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C12H23NO2/c1-9-6-10(8-12(2,3)7-9)13-5-4-11(14)15/h9-10,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | RGPFDOQERAKXST-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid?
The IUPAC name of 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid (CID 43139865) is 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid.
What is the SMILES notation for 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid?
The canonical SMILES for 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid is CC1CC(NCCC(=O)O)CC(C)(C)C1.
What is the InChIKey of 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid?
The InChIKey is RGPFDOQERAKXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-9-6-10(8-12(2,3)7-9)13-5-4-11(14)15/h9-10,13H,4-8H2,1-3H3,(H,14,15).
What are the key properties of 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid?
3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid has a molecular weight of 213.32 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3,5-trimethylcyclohexyl)amino]propanoic acid is sourced from PubChem (CID 43139865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).