C8H10BrNO2S — CID 43139866
3-[(5-bromothiophen-2-yl)methylamino]propanoic acid (PubChem CID 43139866) has the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)methylamino]propanoic acid.
| Compound Name | 3-[(5-bromothiophen-2-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 43139866 |
| Molecular Formula | C8H10BrNO2S |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc(Br)s1 |
| InChI | InChI=1S/C8H10BrNO2S/c9-7-2-1-6(13-7)5-10-4-3-8(11)12/h1-2,10H,3-5H2,(H,11,12) |
| InChIKey | UREZWRZVXFDULQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|